C21H34NO2+ — CID 11918043
(2S)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol (PubChem CID 11918043) has the molecular formula C21H34NO2+ and a molecular weight of 332.51 g/mol. Its IUPAC name is (2S)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 11918043 |
| Molecular Formula | C21H34NO2+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | (2S)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol |
| SMILES | CC(C)c1ccccc1OC[C@@H](O)C[NH+]1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H33NO2/c1-16(2)20-9-5-6-10-21(20)24-15-19(23)14-22-12-11-17-7-3-4-8-18(17)13-22/h5-6,9-10,16-19,23H,3-4,7-8,11-15H2,1-2H3/p+1/t17-,18+,19-/m0/s1 |
| InChIKey | YHPJZFFADHNXOR-OTWHNJEPSA-O |
| XLogP | 2.64 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |