C22H27N3O4 — CID 119182475
3-[1-[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoic acid (PubChem CID 119182475) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[1-[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoic acid.
| Compound Name | 3-[1-[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 119182475 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-[1-[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoic acid |
| SMILES | Cc1nn(-c2ccc(C(=O)N3CCOC4CCCC43)cc2)c(C)c1CCC(=O)O |
| InChI | InChI=1S/C22H27N3O4/c1-14-18(10-11-21(26)27)15(2)25(23-14)17-8-6-16(7-9-17)22(28)24-12-13-29-20-5-3-4-19(20)24/h6-9,19-20H,3-5,10-13H2,1-2H3,(H,26,27) |
| InChIKey | YVXKKGSKINHTRP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |