C14H19NO3S2 — CID 119184955
5-(3-ethylsulfanylazepane-1-carbonyl)thiophene-2-carboxylic acid (PubChem CID 119184955) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 5-(3-ethylsulfanylazepane-1-carbonyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(3-ethylsulfanylazepane-1-carbonyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 119184955 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 5-(3-ethylsulfanylazepane-1-carbonyl)thiophene-2-carboxylic acid |
| SMILES | CCSC1CCCCN(C(=O)c2ccc(C(=O)O)s2)C1 |
| InChI | InChI=1S/C14H19NO3S2/c1-2-19-10-5-3-4-8-15(9-10)13(16)11-6-7-12(20-11)14(17)18/h6-7,10H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | FJEVMYFAVVMCIN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |