C14H20F3N3OS — CID 126836009
(3-ethylsulfanylazepan-1-yl)-[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methanone (PubChem CID 126836009) has the molecular formula C14H20F3N3OS and a molecular weight of 335.40 g/mol. Its IUPAC name is (3-ethylsulfanylazepan-1-yl)-[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methanone.
| Compound Name | (3-ethylsulfanylazepan-1-yl)-[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 126836009 |
| Molecular Formula | C14H20F3N3OS |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3-ethylsulfanylazepan-1-yl)-[1-methyl-4-(trifluoromethyl)pyrazol-5-yl]methanone |
| SMILES | CCSC1CCCCN(C(=O)c2c(C(F)(F)F)cnn2C)C1 |
| InChI | InChI=1S/C14H20F3N3OS/c1-3-22-10-6-4-5-7-20(9-10)13(21)12-11(14(15,16)17)8-18-19(12)2/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | RHWGPPUBAINGJS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |