C16H16N2O7 — CID 119185523
3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]carbamoyl]-5-nitrobenzoic acid (PubChem CID 119185523) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is 3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]carbamoyl]-5-nitrobenzoic acid.
| Compound Name | 3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]carbamoyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 119185523 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]carbamoyl]-5-nitrobenzoic acid |
| SMILES | COCC(NC(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1)c1ccc(C)o1 |
| InChI | InChI=1S/C16H16N2O7/c1-9-3-4-14(25-9)13(8-24-2)17-15(19)10-5-11(16(20)21)7-12(6-10)18(22)23/h3-7,13H,8H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | NFFKHGWIQPBXBI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|