C22H25NO4S — CID 119185942
2-[2-[[4-(cyclopentyloxymethyl)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 119185942) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is 2-[2-[[4-(cyclopentyloxymethyl)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[[4-(cyclopentyloxymethyl)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119185942 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[2-[[4-(cyclopentyloxymethyl)phenyl]carbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | CC(Sc1ccccc1C(=O)Nc1ccc(COC2CCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C22H25NO4S/c1-15(22(25)26)28-20-9-5-4-8-19(20)21(24)23-17-12-10-16(11-13-17)14-27-18-6-2-3-7-18/h4-5,8-13,15,18H,2-3,6-7,14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | LZXRWHJUMRIHTN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |