About 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid
2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid (PubChem CID 119186738) has the molecular formula C18H22N2O6
and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid |
| PubChem CID | 119186738 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)N2C3CCC2CC(=O)NC3)ccc1OCC(=O)O |
| InChI | InChI=1S/C18H22N2O6/c1-2-25-15-7-11(3-6-14(15)26-10-17(22)23)18(24)20-12-4-5-13(20)9-19-16(21)8-12/h3,6-7,12-13H,2,4-5,8-10H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | LWCPPJQKIZBSID-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid?
The IUPAC name of 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid (CID 119186738) is 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid?
The canonical SMILES for 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid is CCOc1cc(C(=O)N2C3CCC2CC(=O)NC3)ccc1OCC(=O)O.
What is the InChIKey of 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid?
The InChIKey is LWCPPJQKIZBSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O6/c1-2-25-15-7-11(3-6-14(15)26-10-17(22)23)18(24)20-12-4-5-13(20)9-19-16(21)8-12/h3,6-7,12-13H,2,4-5,8-10H2,1H3,(H,19,21)(H,22,23).
What are the key properties of 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid?
2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid has a molecular weight of 362.38 g/mol, XLogP of 1.04, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-ethoxy-4-(4-oxo-3,9-diazabicyclo[4.2.1]nonane-9-carbonyl)phenoxy]acetic acid is sourced from PubChem (CID 119186738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).