C19H21NO5S — CID 125152460
2-[2-ethoxy-4-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]phenoxy]acetic acid (PubChem CID 125152460) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 125152460 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[2-ethoxy-4-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)N2CCC[C@@H]2c2cccs2)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H21NO5S/c1-2-24-16-11-13(7-8-15(16)25-12-18(21)22)19(23)20-9-3-5-14(20)17-6-4-10-26-17/h4,6-8,10-11,14H,2-3,5,9,12H2,1H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | ORLZBDBCFJPDNW-CQSZACIVSA-N |
| XLogP | 3.59 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |