C19H21NO5S — CID 119180840
2-[2-ethoxy-4-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenoxy]acetic acid (PubChem CID 119180840) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 119180840 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[2-ethoxy-4-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)N2CCCC2c2ccsc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H21NO5S/c1-2-24-17-10-13(5-6-16(17)25-11-18(21)22)19(23)20-8-3-4-15(20)14-7-9-26-12-14/h5-7,9-10,12,15H,2-4,8,11H2,1H3,(H,21,22) |
| InChIKey | GMSUYHHKBACVIQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |