C18H19ClN2O4S — CID 43045600
2-[2-chloro-6-methoxy-4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenoxy]acetamide (PubChem CID 43045600) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is 2-[2-chloro-6-methoxy-4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-methoxy-4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 43045600 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[2-chloro-6-methoxy-4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenoxy]acetamide |
| SMILES | COc1cc(C(=O)N2CCCC2c2cccs2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C18H19ClN2O4S/c1-24-14-9-11(8-12(19)17(14)25-10-16(20)22)18(23)21-6-2-4-13(21)15-5-3-7-26-15/h3,5,7-9,13H,2,4,6,10H2,1H3,(H2,20,22) |
| InChIKey | VOSMPPRISSGLPJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |