C18H21ClN2O3S — CID 17423018
2-(5-chloro-2,4-dimethoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 17423018) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(5-chloro-2,4-dimethoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 17423018 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | COc1cc(OC)c(NCC(=O)N2CCCC2c2cccs2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O3S/c1-23-15-10-16(24-2)13(9-12(15)19)20-11-18(22)21-7-3-5-14(21)17-6-4-8-25-17/h4,6,8-10,14,20H,3,5,7,11H2,1-2H3 |
| InChIKey | WUKUMLPMPRMQFR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|