C16H16ClFN2OS — CID 26508346
2-(3-chloro-4-fluoroanilino)-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone (PubChem CID 26508346) has the molecular formula C16H16ClFN2OS and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoroanilino)-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-(3-chloro-4-fluoroanilino)-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 26508346 |
| Molecular Formula | C16H16ClFN2OS |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-(3-chloro-4-fluoroanilino)-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
| SMILES | O=C(CNc1ccc(F)c(Cl)c1)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C16H16ClFN2OS/c17-12-9-11(5-6-13(12)18)19-10-16(21)20-7-1-3-14(20)15-4-2-8-22-15/h2,4-6,8-9,14,19H,1,3,7,10H2/t14-/m0/s1 |
| InChIKey | OGDNOPTVEGEJKV-AWEZNQCLSA-N |
| XLogP | 4.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |