C17H18F2N2O2S — CID 55918213
2-(3,5-difluoro-4-methoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 55918213) has the molecular formula C17H18F2N2O2S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(3,5-difluoro-4-methoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 55918213 |
| Molecular Formula | C17H18F2N2O2S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-(3,5-difluoro-4-methoxyanilino)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | COc1c(F)cc(NCC(=O)N2CCCC2c2cccs2)cc1F |
| InChI | InChI=1S/C17H18F2N2O2S/c1-23-17-12(18)8-11(9-13(17)19)20-10-16(22)21-6-2-4-14(21)15-5-3-7-24-15/h3,5,7-9,14,20H,2,4,6,10H2,1H3 |
| InChIKey | HAMXDXQXBLLUCK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|