C18H20ClN3O2S — CID 94630105
5-chloro-N-methyl-2-[[2-oxo-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]amino]benzamide (PubChem CID 94630105) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is 5-chloro-N-methyl-2-[[2-oxo-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]amino]benzamide.
| Compound Name | 5-chloro-N-methyl-2-[[2-oxo-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 94630105 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 5-chloro-N-methyl-2-[[2-oxo-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]amino]benzamide |
| SMILES | CNC(=O)c1cc(Cl)ccc1NCC(=O)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C18H20ClN3O2S/c1-20-18(24)13-10-12(19)6-7-14(13)21-11-17(23)22-8-2-4-15(22)16-5-3-9-25-16/h3,5-7,9-10,15,21H,2,4,8,11H2,1H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | LMIPZXZQVCBECB-HNNXBMFYSA-N |
| XLogP | 3.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |