C20H29NO5 — CID 119187218
2-[3-[(3-butoxy-2,2-dimethylcyclobutyl)-methylcarbamoyl]phenoxy]acetic acid (PubChem CID 119187218) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-[3-[(3-butoxy-2,2-dimethylcyclobutyl)-methylcarbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(3-butoxy-2,2-dimethylcyclobutyl)-methylcarbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119187218 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-[3-[(3-butoxy-2,2-dimethylcyclobutyl)-methylcarbamoyl]phenoxy]acetic acid |
| SMILES | CCCCOC1CC(N(C)C(=O)c2cccc(OCC(=O)O)c2)C1(C)C |
| InChI | InChI=1S/C20H29NO5/c1-5-6-10-25-17-12-16(20(17,2)3)21(4)19(24)14-8-7-9-15(11-14)26-13-18(22)23/h7-9,11,16-17H,5-6,10,12-13H2,1-4H3,(H,22,23) |
| InChIKey | FLWYQQOOQGGWLM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|