C18H25N3O2 — CID 124877466
N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-4-cyano-N-methylpyridine-2-carboxamide (PubChem CID 124877466) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-4-cyano-N-methylpyridine-2-carboxamide.
| Compound Name | N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-4-cyano-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 124877466 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-4-cyano-N-methylpyridine-2-carboxamide |
| SMILES | CCCCO[C@H]1C[C@H](N(C)C(=O)c2cc(C#N)ccn2)C1(C)C |
| InChI | InChI=1S/C18H25N3O2/c1-5-6-9-23-16-11-15(18(16,2)3)21(4)17(22)14-10-13(12-19)7-8-20-14/h7-8,10,15-16H,5-6,9,11H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | NRTBKZTZIRZBFJ-HOTGVXAUSA-N |
| XLogP | 3.01 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|