C20H29N3O4S — CID 95786987
N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methyl-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 95786987) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methyl-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methyl-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 95786987 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[(1S,3S)-3-butoxy-2,2-dimethylcyclobutyl]-N-methyl-3-methylsulfonylimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CCCCO[C@H]1C[C@H](N(C)C(=O)c2nc(S(C)(=O)=O)n3ccccc23)C1(C)C |
| InChI | InChI=1S/C20H29N3O4S/c1-6-7-12-27-16-13-15(20(16,2)3)22(4)18(24)17-14-10-8-9-11-23(14)19(21-17)28(5,25)26/h8-11,15-16H,6-7,12-13H2,1-5H3/t15-,16-/m0/s1 |
| InChIKey | RBDWTGOMZFXBMN-HOTGVXAUSA-N |
| XLogP | 2.79 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|