C16H16F3NO3 — CID 119197237
2-[cyclopent-3-ene-1-carbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid (PubChem CID 119197237) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-[cyclopent-3-ene-1-carbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[cyclopent-3-ene-1-carbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 119197237 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[cyclopent-3-ene-1-carbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccc(C(F)(F)F)cc1)C(=O)C1CC=CC1 |
| InChI | InChI=1S/C16H16F3NO3/c17-16(18,19)13-7-5-11(6-8-13)9-20(10-14(21)22)15(23)12-3-1-2-4-12/h1-2,5-8,12H,3-4,9-10H2,(H,21,22) |
| InChIKey | JUPKKOZRMYBBGU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|