C19H22N2O5S — CID 119200789
2-methyl-2-[methyl-[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]propanoic acid (PubChem CID 119200789) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-methyl-2-[methyl-[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[methyl-[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119200789 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-methyl-2-[methyl-[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]propanoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)N(C)C(C)(C)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-13-8-10-15(11-9-13)20-27(25,26)16-7-5-6-14(12-16)17(22)21(4)19(2,3)18(23)24/h5-12,20H,1-4H3,(H,23,24) |
| InChIKey | QTAWWRDCWVMBEU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |