C17H23N3O5S — CID 119201528
2-[[2-(diethylsulfamoyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 119201528) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[[2-(diethylsulfamoyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-(diethylsulfamoyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 119201528 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[[2-(diethylsulfamoyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCN(CC)S(=O)(=O)CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H23N3O5S/c1-3-20(4-2)26(24,25)11-16(21)19-15(17(22)23)9-12-10-18-14-8-6-5-7-13(12)14/h5-8,10,15,18H,3-4,9,11H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | DMNDNKNLGUDNTI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |