C16H17N3O4 — CID 119201712
2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-2-phenylbutanoic acid (PubChem CID 119201712) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-2-phenylbutanoic acid.
| Compound Name | 2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 119201712 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-2-phenylbutanoic acid |
| SMILES | CCC(NC(=O)c1ccc(=O)n(C)n1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O4/c1-3-16(15(22)23,11-7-5-4-6-8-11)17-14(21)12-9-10-13(20)19(2)18-12/h4-10H,3H2,1-2H3,(H,17,21)(H,22,23) |
| InChIKey | UCRWVEWNJJZFFR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |