C14H16N2O5S — CID 119202171
2-[cyclopropyl-[2-(4-nitrophenyl)sulfanylacetyl]amino]propanoic acid (PubChem CID 119202171) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-(4-nitrophenyl)sulfanylacetyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[2-(4-nitrophenyl)sulfanylacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119202171 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[cyclopropyl-[2-(4-nitrophenyl)sulfanylacetyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C(=O)CSc1ccc([N+](=O)[O-])cc1)C1CC1 |
| InChI | InChI=1S/C14H16N2O5S/c1-9(14(18)19)15(10-2-3-10)13(17)8-22-12-6-4-11(5-7-12)16(20)21/h4-7,9-10H,2-3,8H2,1H3,(H,18,19) |
| InChIKey | BWAOWAOAHUXURN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|