C18H22F3NO4 — CID 119211337
2-[oxan-4-yl-[3-[2-(trifluoromethyl)phenyl]butanoyl]amino]acetic acid (PubChem CID 119211337) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-[oxan-4-yl-[3-[2-(trifluoromethyl)phenyl]butanoyl]amino]acetic acid.
| Compound Name | 2-[oxan-4-yl-[3-[2-(trifluoromethyl)phenyl]butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119211337 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[oxan-4-yl-[3-[2-(trifluoromethyl)phenyl]butanoyl]amino]acetic acid |
| SMILES | CC(CC(=O)N(CC(=O)O)C1CCOCC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO4/c1-12(14-4-2-3-5-15(14)18(19,20)21)10-16(23)22(11-17(24)25)13-6-8-26-9-7-13/h2-5,12-13H,6-11H2,1H3,(H,24,25) |
| InChIKey | CVPLZIKQBPDEOT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |