C18H22F3NO3 — CID 122113516
6-methyl-1-[3-[2-(trifluoromethyl)phenyl]butanoyl]piperidine-3-carboxylic acid (PubChem CID 122113516) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 6-methyl-1-[3-[2-(trifluoromethyl)phenyl]butanoyl]piperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-[3-[2-(trifluoromethyl)phenyl]butanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113516 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6-methyl-1-[3-[2-(trifluoromethyl)phenyl]butanoyl]piperidine-3-carboxylic acid |
| SMILES | CC(CC(=O)N1CC(C(=O)O)CCC1C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO3/c1-11(14-5-3-4-6-15(14)18(19,20)21)9-16(23)22-10-13(17(24)25)8-7-12(22)2/h3-6,11-13H,7-10H2,1-2H3,(H,24,25) |
| InChIKey | AOVMCZJWWMBSJP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |