C15H16N4O6 — CID 119215107
2-[4-[(5-nitro-1H-indazole-3-carbonyl)amino]oxan-4-yl]acetic acid (PubChem CID 119215107) has the molecular formula C15H16N4O6 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-[4-[(5-nitro-1H-indazole-3-carbonyl)amino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[(5-nitro-1H-indazole-3-carbonyl)amino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119215107 |
| Molecular Formula | C15H16N4O6 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[4-[(5-nitro-1H-indazole-3-carbonyl)amino]oxan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)CCOCC1 |
| InChI | InChI=1S/C15H16N4O6/c20-12(21)8-15(3-5-25-6-4-15)16-14(22)13-10-7-9(19(23)24)1-2-11(10)17-18-13/h1-2,7H,3-6,8H2,(H,16,22)(H,17,18)(H,20,21) |
| InChIKey | KTXKYRXCQOZIRB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|