C19H17N3O5S — CID 11921543
N-[(E)-[(1R,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]thiophene-3-carboxamide (PubChem CID 11921543) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-[(E)-[(1R,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]thiophene-3-carboxamide.
| Compound Name | N-[(E)-[(1R,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 11921543 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[(E)-[(1R,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]thiophene-3-carboxamide |
| SMILES | COc1ccc(C2=NO[C@@H]3[C@H]4CO[C@H](O4)/C(=N/NC(=O)c4ccsc4)[C@H]23)cc1 |
| InChI | InChI=1S/C19H17N3O5S/c1-24-12-4-2-10(3-5-12)15-14-16(20-21-18(23)11-6-7-28-9-11)19-25-8-13(26-19)17(14)27-22-15/h2-7,9,13-14,17,19H,8H2,1H3,(H,21,23)/b20-16+/t13-,14+,17-,19-/m1/s1 |
| InChIKey | WLPRYIDFGAYGMT-VWZRAIQGSA-N |
| XLogP | 2.02 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|