C23H19FN4O5 — CID 98077430
5-fluoro-N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]-1H-indole-2-carboxamide (PubChem CID 98077430) has the molecular formula C23H19FN4O5 and a molecular weight of 450.43 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 98077430 |
| Molecular Formula | C23H19FN4O5 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 5-fluoro-N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(C2=NO[C@@H]3[C@@H]4CO[C@H](O4)/C(=N/NC(=O)c4cc5cc(F)ccc5[nH]4)[C@H]23)cc1 |
| InChI | InChI=1S/C23H19FN4O5/c1-30-14-5-2-11(3-6-14)19-18-20(23-31-10-17(32-23)21(18)33-28-19)26-27-22(29)16-9-12-8-13(24)4-7-15(12)25-16/h2-9,17-18,21,23,25H,10H2,1H3,(H,27,29)/b26-20+/t17-,18-,21+,23+/m0/s1 |
| InChIKey | NFOVOJOJPSUICL-FRGPQPJGSA-N |
| XLogP | 2.58 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|