C15H18N2O4 — CID 91762188
N-[(3S,4R)-3-hydroxyoxan-4-yl]-5-methoxy-1H-indole-2-carboxamide (PubChem CID 91762188) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(3S,4R)-3-hydroxyoxan-4-yl]-5-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(3S,4R)-3-hydroxyoxan-4-yl]-5-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91762188 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[(3S,4R)-3-hydroxyoxan-4-yl]-5-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)N[C@@H]3CCOC[C@H]3O)cc2c1 |
| InChI | InChI=1S/C15H18N2O4/c1-20-10-2-3-11-9(6-10)7-13(16-11)15(19)17-12-4-5-21-8-14(12)18/h2-3,6-7,12,14,16,18H,4-5,8H2,1H3,(H,17,19)/t12-,14-/m1/s1 |
| InChIKey | WCXBCNVRFUTJIU-TZMCWYRMSA-N |
| XLogP | 1.06 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |