C16H17N3O4S — CID 98077428
N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]ethanethioamide (PubChem CID 98077428) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]ethanethioamide.
| Compound Name | N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]ethanethioamide |
|---|---|
| PubChem CID | 98077428 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[(E)-[(1S,2S,6R,8R)-5-(4-methoxyphenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-ylidene]amino]ethanethioamide |
| SMILES | COc1ccc(C2=NO[C@@H]3[C@@H]4CO[C@H](O4)/C(=N/NC(C)=S)[C@H]23)cc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-8(24)17-18-14-12-13(9-3-5-10(20-2)6-4-9)19-23-15(12)11-7-21-16(14)22-11/h3-6,11-12,15-16H,7H2,1-2H3,(H,17,24)/b18-14+/t11-,12-,15+,16+/m0/s1 |
| InChIKey | WKUKFHWOJANEEF-HNJCYUIESA-N |
| XLogP | 1.46 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|