C23H27N2O4+ — CID 11921554
(3R)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 11921554) has the molecular formula C23H27N2O4+ and a molecular weight of 395.48 g/mol. Its IUPAC name is (3R)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11921554 |
| Molecular Formula | C23H27N2O4+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (3R)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCCC[C@@H]2CCO)C(=O)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O4/c26-15-13-17-6-4-5-14-24(17)21-16-22(27)25(23(21)28)18-9-11-20(12-10-18)29-19-7-2-1-3-8-19/h1-3,7-12,17,21,26H,4-6,13-16H2/p+1/t17-,21-/m1/s1 |
| InChIKey | GXSPUGSBLXUWIE-DYESRHJHSA-O |
| XLogP | 1.93 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|