C17H22ClN2O3+ — CID 11909889
(3R)-1-(4-chlorophenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 11909889) has the molecular formula C17H22ClN2O3+ and a molecular weight of 337.83 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-chlorophenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11909889 |
| Molecular Formula | C17H22ClN2O3+ |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCCC[C@@H]2CCO)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O3/c18-12-4-6-14(7-5-12)20-16(22)11-15(17(20)23)19-9-2-1-3-13(19)8-10-21/h4-7,13,15,21H,1-3,8-11H2/p+1/t13-,15-/m1/s1 |
| InChIKey | HHBNQLAZVQFYEH-UKRRQHHQSA-O |
| XLogP | 0.79 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|