C22H25N3O4 — CID 119219361
3-[[1-(benzylcarbamoylamino)cyclopentanecarbonyl]amino]-4-methylbenzoic acid (PubChem CID 119219361) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[[1-(benzylcarbamoylamino)cyclopentanecarbonyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[1-(benzylcarbamoylamino)cyclopentanecarbonyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 119219361 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[[1-(benzylcarbamoylamino)cyclopentanecarbonyl]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)C1(NC(=O)NCc2ccccc2)CCCC1 |
| InChI | InChI=1S/C22H25N3O4/c1-15-9-10-17(19(26)27)13-18(15)24-20(28)22(11-5-6-12-22)25-21(29)23-14-16-7-3-2-4-8-16/h2-4,7-10,13H,5-6,11-12,14H2,1H3,(H,24,28)(H,26,27)(H2,23,25,29) |
| InChIKey | YMIZYPIZHPBWQX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |