C17H18N2O2S — CID 971503
4-methyl-3-[(4-methylphenyl)methylcarbamothioylamino]benzoic acid (PubChem CID 971503) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-methyl-3-[(4-methylphenyl)methylcarbamothioylamino]benzoic acid.
| Compound Name | 4-methyl-3-[(4-methylphenyl)methylcarbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 971503 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-methyl-3-[(4-methylphenyl)methylcarbamothioylamino]benzoic acid |
| SMILES | Cc1ccc(CNC(=S)Nc2cc(C(=O)O)ccc2C)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-11-3-6-13(7-4-11)10-18-17(22)19-15-9-14(16(20)21)8-5-12(15)2/h3-9H,10H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | VQGCUXRDPOSANH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|