C23H28N4O3 — CID 55972370
N-(3-acetamido-4-methylphenyl)-1-(benzylcarbamoylamino)cyclopentane-1-carboxamide (PubChem CID 55972370) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(3-acetamido-4-methylphenyl)-1-(benzylcarbamoylamino)cyclopentane-1-carboxamide.
| Compound Name | N-(3-acetamido-4-methylphenyl)-1-(benzylcarbamoylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55972370 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-(3-acetamido-4-methylphenyl)-1-(benzylcarbamoylamino)cyclopentane-1-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)C2(NC(=O)NCc3ccccc3)CCCC2)ccc1C |
| InChI | InChI=1S/C23H28N4O3/c1-16-10-11-19(14-20(16)25-17(2)28)26-21(29)23(12-6-7-13-23)27-22(30)24-15-18-8-4-3-5-9-18/h3-5,8-11,14H,6-7,12-13,15H2,1-2H3,(H,25,28)(H,26,29)(H2,24,27,30) |
| InChIKey | ZHUXAOYKYOWRCX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |