C14H18N4O3S — CID 119219901
6-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]hexanoic acid (PubChem CID 119219901) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 6-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119219901 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 6-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1cn(Cc2cccs2)nn1 |
| InChI | InChI=1S/C14H18N4O3S/c19-13(20)6-2-1-3-7-15-14(21)12-10-18(17-16-12)9-11-5-4-8-22-11/h4-5,8,10H,1-3,6-7,9H2,(H,15,21)(H,19,20) |
| InChIKey | VLECDEXFCHKXAK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|