C13H16N4O3S — CID 119191173
3-[ethyl-[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid (PubChem CID 119191173) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-[ethyl-[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119191173 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-[ethyl-[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)c1cn(Cc2cccs2)nn1 |
| InChI | InChI=1S/C13H16N4O3S/c1-2-16(6-5-12(18)19)13(20)11-9-17(15-14-11)8-10-4-3-7-21-10/h3-4,7,9H,2,5-6,8H2,1H3,(H,18,19) |
| InChIKey | PADOPYLQVYMYTH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |