C11H12N4O3S — CID 119225272
2-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid (PubChem CID 119225272) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119225272 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[[1-(thiophen-2-ylmethyl)triazole-4-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)c1cn(Cc2cccs2)nn1)C(=O)O |
| InChI | InChI=1S/C11H12N4O3S/c1-7(11(17)18)12-10(16)9-6-15(14-13-9)5-8-3-2-4-19-8/h2-4,6-7H,5H2,1H3,(H,12,16)(H,17,18) |
| InChIKey | OMGBXIVRIOWSOG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |