C17H16F3N3O3 — CID 119227143
1-[3-(cyclopentanecarbonylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 119227143) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 1-[3-(cyclopentanecarbonylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-[3-(cyclopentanecarbonylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 119227143 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[3-(cyclopentanecarbonylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2cccc(NC(=O)C3CCCC3)c2)c1C(F)(F)F |
| InChI | InChI=1S/C17H16F3N3O3/c18-17(19,20)14-13(16(25)26)9-21-23(14)12-7-3-6-11(8-12)22-15(24)10-4-1-2-5-10/h3,6-10H,1-2,4-5H2,(H,22,24)(H,25,26) |
| InChIKey | KCWIZBZOJGYMET-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |