C18H18F3N3O3 — CID 120523969
1-[4-(3-cyclobutylpropanoylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 120523969) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 1-[4-(3-cyclobutylpropanoylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-[4-(3-cyclobutylpropanoylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 120523969 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-[4-(3-cyclobutylpropanoylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | O=C(CCC1CCC1)Nc1ccc(-n2ncc(C(=O)O)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3N3O3/c19-18(20,21)16-14(17(26)27)10-22-24(16)13-7-5-12(6-8-13)23-15(25)9-4-11-2-1-3-11/h5-8,10-11H,1-4,9H2,(H,23,25)(H,26,27) |
| InChIKey | FGBROUJCEKNNIB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |