C17H18F3N3O4 — CID 119227086
1-[4-[(2-butoxyacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 119227086) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-[4-[(2-butoxyacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-[4-[(2-butoxyacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 119227086 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-[4-[(2-butoxyacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | CCCCOCC(=O)Nc1ccc(-n2ncc(C(=O)O)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3N3O4/c1-2-3-8-27-10-14(24)22-11-4-6-12(7-5-11)23-15(17(18,19)20)13(9-21-23)16(25)26/h4-7,9H,2-3,8,10H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | HIFWSFHQLOEXAQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|