2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid

C15H17N3O6 — CID 119230555

IUPAC2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid
SMILESCOc1cc(C(=O)Nc2ccn(CC(=O)O)n2)cc(OC)c1OC
InChIInChI=1S/C15H17N3O6/c1-22-10-6-9(7-11(23-2)14(10)24-3)15(21)16-12-4-5-18(17-12)8-13(19)20/h4-7H,8H2,1-3H3,(H,19,20)(H,16,17,21)
InChIKeyNIQKOXHTDLOAQP-UHFFFAOYSA-N
MW335.32 g/mol
LogP1.25
Rot. Bonds7

About 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid

2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid (PubChem CID 119230555) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid.

Molecular Properties

Compound Name2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid
PubChem CID119230555
Molecular FormulaC15H17N3O6
Molecular Weight335.32 g/mol
Exact Mass335.11
IUPAC Name2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid
SMILESCOc1cc(C(=O)Nc2ccn(CC(=O)O)n2)cc(OC)c1OC
InChIInChI=1S/C15H17N3O6/c1-22-10-6-9(7-11(23-2)14(10)24-3)15(21)16-12-4-5-18(17-12)8-13(19)20/h4-7H,8H2,1-3H3,(H,19,20)(H,16,17,21)
InChIKeyNIQKOXHTDLOAQP-UHFFFAOYSA-N
XLogP1.25
TPSA111.91 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.32
LogP ≤ 51.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid?
The IUPAC name of 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid (CID 119230555) is 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid.
What is the SMILES notation for 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid?
The canonical SMILES for 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid is COc1cc(C(=O)Nc2ccn(CC(=O)O)n2)cc(OC)c1OC.
What is the InChIKey of 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid?
The InChIKey is NIQKOXHTDLOAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O6/c1-22-10-6-9(7-11(23-2)14(10)24-3)15(21)16-12-4-5-18(17-12)8-13(19)20/h4-7H,8H2,1-3H3,(H,19,20)(H,16,17,21).
What are the key properties of 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid?
2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid has a molecular weight of 335.32 g/mol, XLogP of 1.25, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(3,4,5-trimethoxybenzoyl)amino]pyrazol-1-yl]acetic acid is sourced from PubChem (CID 119230555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).