C19H28N2O3 — CID 11923386
(2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]propanamide (PubChem CID 11923386) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]propanamide.
| Compound Name | (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]propanamide |
|---|---|
| PubChem CID | 11923386 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]propanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1N[C@@H](C)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H28N2O3/c1-12-5-4-6-16(13(12)2)20-14(3)19(22)21-15-7-8-17-18(11-15)24-10-9-23-17/h7-8,11-14,16,20H,4-6,9-10H2,1-3H3,(H,21,22)/t12-,13-,14+,16+/m1/s1 |
| InChIKey | XHOREYPCFXBOBB-NYTXWWLZSA-N |
| XLogP | 3.20 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |