C18H27N2O3+ — CID 8875769
cyclopentyl-[(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl]-dimethylazanium (PubChem CID 8875769) has the molecular formula C18H27N2O3+ and a molecular weight of 319.43 g/mol. Its IUPAC name is cyclopentyl-[(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl]-dimethylazanium.
| Compound Name | cyclopentyl-[(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 8875769 |
| Molecular Formula | C18H27N2O3+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | cyclopentyl-[(2S)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl]-dimethylazanium |
| SMILES | C[C@@H](C(=O)Nc1ccc2c(c1)OCCO2)[N+](C)(C)C1CCCC1 |
| InChI | InChI=1S/C18H26N2O3/c1-13(20(2,3)15-6-4-5-7-15)18(21)19-14-8-9-16-17(12-14)23-11-10-22-16/h8-9,12-13,15H,4-7,10-11H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | ZJFIYAAJLLARDK-ZDUSSCGKSA-O |
| XLogP | 2.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|