C18H19N3O4 — CID 119235412
2-[5-[(5-tert-butyl-1,2-oxazole-3-carbonyl)amino]indol-1-yl]acetic acid (PubChem CID 119235412) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[5-[(5-tert-butyl-1,2-oxazole-3-carbonyl)amino]indol-1-yl]acetic acid.
| Compound Name | 2-[5-[(5-tert-butyl-1,2-oxazole-3-carbonyl)amino]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119235412 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[5-[(5-tert-butyl-1,2-oxazole-3-carbonyl)amino]indol-1-yl]acetic acid |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccc3c(ccn3CC(=O)O)c2)no1 |
| InChI | InChI=1S/C18H19N3O4/c1-18(2,3)15-9-13(20-25-15)17(24)19-12-4-5-14-11(8-12)6-7-21(14)10-16(22)23/h4-9H,10H2,1-3H3,(H,19,24)(H,22,23) |
| InChIKey | NRGCOZUERSLQHT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |