C14H14F3NO4 — CID 119237973
(2S)-2-[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]propanoic acid (PubChem CID 119237973) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is (2S)-2-[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119237973 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2S)-2-[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]propanoic acid |
| SMILES | C=CCOc1ccc(C(F)(F)F)cc1C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H14F3NO4/c1-3-6-22-11-5-4-9(14(15,16)17)7-10(11)12(19)18-8(2)13(20)21/h3-5,7-8H,1,6H2,2H3,(H,18,19)(H,20,21)/t8-/m0/s1 |
| InChIKey | KXAJEIWKKZAYBT-QMMMGPOBSA-N |
| XLogP | 2.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|