C16H15F3N4O4 — CID 120699011
2-[4-[[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120699011) has the molecular formula C16H15F3N4O4 and a molecular weight of 384.31 g/mol. Its IUPAC name is 2-[4-[[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120699011 |
| Molecular Formula | C16H15F3N4O4 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[4-[[[2-prop-2-enoxy-5-(trifluoromethyl)benzoyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | C=CCOc1ccc(C(F)(F)F)cc1C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C16H15F3N4O4/c1-2-5-27-13-4-3-10(16(17,18)19)6-12(13)15(26)20-7-11-8-23(22-21-11)9-14(24)25/h2-4,6,8H,1,5,7,9H2,(H,20,26)(H,24,25) |
| InChIKey | GCSZWLKTVLIEEE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|