C17H21F3N2O2 — CID 120577557
N-(2-methylpiperidin-3-yl)-2-prop-2-enoxy-5-(trifluoromethyl)benzamide (PubChem CID 120577557) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-2-prop-2-enoxy-5-(trifluoromethyl)benzamide.
| Compound Name | N-(2-methylpiperidin-3-yl)-2-prop-2-enoxy-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 120577557 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-2-prop-2-enoxy-5-(trifluoromethyl)benzamide |
| SMILES | C=CCOc1ccc(C(F)(F)F)cc1C(=O)NC1CCCNC1C |
| InChI | InChI=1S/C17H21F3N2O2/c1-3-9-24-15-7-6-12(17(18,19)20)10-13(15)16(23)22-14-5-4-8-21-11(14)2/h3,6-7,10-11,14,21H,1,4-5,8-9H2,2H3,(H,22,23) |
| InChIKey | FBEFGYBYEPGKCD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|