C14H19NO4S — CID 119241694
2-[2-[[2-(2,4-dimethylphenoxy)acetyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241694) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[2-[[2-(2,4-dimethylphenoxy)acetyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[2-(2,4-dimethylphenoxy)acetyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241694 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[2-[[2-(2,4-dimethylphenoxy)acetyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1ccc(OCC(=O)NCCSCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-10-3-4-12(11(2)7-10)19-8-13(16)15-5-6-20-9-14(17)18/h3-4,7H,5-6,8-9H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | WNDDJOOEBGIGEC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|