C20H21FN2O5 — CID 119247084
4-[4-[[(3-acetamido-4-fluorobenzoyl)amino]methyl]phenoxy]butanoic acid (PubChem CID 119247084) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is 4-[4-[[(3-acetamido-4-fluorobenzoyl)amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[(3-acetamido-4-fluorobenzoyl)amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119247084 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-[4-[[(3-acetamido-4-fluorobenzoyl)amino]methyl]phenoxy]butanoic acid |
| SMILES | CC(=O)Nc1cc(C(=O)NCc2ccc(OCCCC(=O)O)cc2)ccc1F |
| InChI | InChI=1S/C20H21FN2O5/c1-13(24)23-18-11-15(6-9-17(18)21)20(27)22-12-14-4-7-16(8-5-14)28-10-2-3-19(25)26/h4-9,11H,2-3,10,12H2,1H3,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | VZFRWGRLWPZVEV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|