C16H20N2O5S — CID 119247191
4-[4-[[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]methyl]phenoxy]butanoic acid (PubChem CID 119247191) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-[4-[[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119247191 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-[4-[[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]methyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(CNC(=O)CN2CSCC2=O)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c19-14(9-18-11-24-10-15(18)20)17-8-12-3-5-13(6-4-12)23-7-1-2-16(21)22/h3-6H,1-2,7-11H2,(H,17,19)(H,21,22) |
| InChIKey | QFJNZWWNDAUXPR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|